C10H9ClO3 — CID 83885874
2-(4-chloro-7-hydroxy-2,3-dihydro-1-benzofuran-6-yl)acetaldehyde (PubChem CID 83885874) has the molecular formula C10H9ClO3 and a molecular weight of 212.63 g/mol. Its IUPAC name is 2-(4-chloro-7-hydroxy-2,3-dihydro-1-benzofuran-6-yl)acetaldehyde.
| Compound Name | 2-(4-chloro-7-hydroxy-2,3-dihydro-1-benzofuran-6-yl)acetaldehyde |
|---|---|
| PubChem CID | 83885874 |
| Molecular Formula | C10H9ClO3 |
| Molecular Weight | 212.63 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | 2-(4-chloro-7-hydroxy-2,3-dihydro-1-benzofuran-6-yl)acetaldehyde |
| SMILES | O=CCc1cc(Cl)c2c(c1O)OCC2 |
| InChI | InChI=1S/C10H9ClO3/c11-8-5-6(1-3-12)9(13)10-7(8)2-4-14-10/h3,5,13H,1-2,4H2 |
| InChIKey | POEVABPELAXAFH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.63 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|