methyl 2-bromo-4-oxo-6,7-dihydro-5H-1-benzofuran-6-carboxylate

C10H9BrO4 — CID 83920481

IUPACmethyl 2-bromo-4-oxo-6,7-dihydro-5H-1-benzofuran-6-carboxylate
SMILESCOC(=O)C1CC(=O)c2cc(Br)oc2C1
InChIInChI=1S/C10H9BrO4/c1-14-10(13)5-2-7(12)6-4-9(11)15-8(6)3-5/h4-5H,2-3H2,1H3
InChIKeyRMQWTPVCTMPQDA-UHFFFAOYSA-N
MW273.08 g/mol
LogP1.96
Rot. Bonds1

About methyl 2-bromo-4-oxo-6,7-dihydro-5H-1-benzofuran-6-carboxylate

methyl 2-bromo-4-oxo-6,7-dihydro-5H-1-benzofuran-6-carboxylate (PubChem CID 83920481) has the molecular formula C10H9BrO4 and a molecular weight of 273.08 g/mol. Its IUPAC name is methyl 2-bromo-4-oxo-6,7-dihydro-5H-1-benzofuran-6-carboxylate.

Molecular Properties

Compound Namemethyl 2-bromo-4-oxo-6,7-dihydro-5H-1-benzofuran-6-carboxylate
PubChem CID83920481
Molecular FormulaC10H9BrO4
Molecular Weight273.08 g/mol
Exact Mass271.97
IUPAC Namemethyl 2-bromo-4-oxo-6,7-dihydro-5H-1-benzofuran-6-carboxylate
SMILESCOC(=O)C1CC(=O)c2cc(Br)oc2C1
InChIInChI=1S/C10H9BrO4/c1-14-10(13)5-2-7(12)6-4-9(11)15-8(6)3-5/h4-5H,2-3H2,1H3
InChIKeyRMQWTPVCTMPQDA-UHFFFAOYSA-N
XLogP1.96
TPSA56.51 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500273.08
LogP ≤ 51.96
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 2-bromo-4-oxo-6,7-dihydro-5H-1-benzofuran-6-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-bromo-4-oxo-6,7-dihydro-5H-1-benzofuran-6-carboxylate?
The IUPAC name of methyl 2-bromo-4-oxo-6,7-dihydro-5H-1-benzofuran-6-carboxylate (CID 83920481) is methyl 2-bromo-4-oxo-6,7-dihydro-5H-1-benzofuran-6-carboxylate.
What is the SMILES notation for methyl 2-bromo-4-oxo-6,7-dihydro-5H-1-benzofuran-6-carboxylate?
The canonical SMILES for methyl 2-bromo-4-oxo-6,7-dihydro-5H-1-benzofuran-6-carboxylate is COC(=O)C1CC(=O)c2cc(Br)oc2C1.
What is the InChIKey of methyl 2-bromo-4-oxo-6,7-dihydro-5H-1-benzofuran-6-carboxylate?
The InChIKey is RMQWTPVCTMPQDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrO4/c1-14-10(13)5-2-7(12)6-4-9(11)15-8(6)3-5/h4-5H,2-3H2,1H3.
What are the key properties of methyl 2-bromo-4-oxo-6,7-dihydro-5H-1-benzofuran-6-carboxylate?
methyl 2-bromo-4-oxo-6,7-dihydro-5H-1-benzofuran-6-carboxylate has a molecular weight of 273.08 g/mol, XLogP of 1.96, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-bromo-4-oxo-6,7-dihydro-5H-1-benzofuran-6-carboxylate is sourced from PubChem (CID 83920481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).