C10H10Cl3NS — CID 83925137
3-(2,3,6-trichlorophenyl)butanethioamide (PubChem CID 83925137) has the molecular formula C10H10Cl3NS and a molecular weight of 282.62 g/mol. Its IUPAC name is 3-(2,3,6-trichlorophenyl)butanethioamide.
| Compound Name | 3-(2,3,6-trichlorophenyl)butanethioamide |
|---|---|
| PubChem CID | 83925137 |
| Molecular Formula | C10H10Cl3NS |
| Molecular Weight | 282.62 g/mol |
| Exact Mass | 280.96 |
| IUPAC Name | 3-(2,3,6-trichlorophenyl)butanethioamide |
| SMILES | CC(CC(N)=S)c1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C10H10Cl3NS/c1-5(4-8(14)15)9-6(11)2-3-7(12)10(9)13/h2-3,5H,4H2,1H3,(H2,14,15) |
| InChIKey | UGMXOMDJLNXNQE-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.62 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|