C12H12F3NO3S — CID 83984896
1,1,1-trifluoro-2-(5-methylsulfonyl-1H-indol-3-yl)propan-2-ol (PubChem CID 83984896) has the molecular formula C12H12F3NO3S and a molecular weight of 307.29 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-(5-methylsulfonyl-1H-indol-3-yl)propan-2-ol.
| Compound Name | 1,1,1-trifluoro-2-(5-methylsulfonyl-1H-indol-3-yl)propan-2-ol |
|---|---|
| PubChem CID | 83984896 |
| Molecular Formula | C12H12F3NO3S |
| Molecular Weight | 307.29 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 1,1,1-trifluoro-2-(5-methylsulfonyl-1H-indol-3-yl)propan-2-ol |
| SMILES | CC(O)(c1c[nH]c2ccc(S(C)(=O)=O)cc12)C(F)(F)F |
| InChI | InChI=1S/C12H12F3NO3S/c1-11(17,12(13,14)15)9-6-16-10-4-3-7(5-8(9)10)20(2,18)19/h3-6,16-17H,1-2H3 |
| InChIKey | ZFMFTHYLVBIPKF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |