C14H12N4O3S — CID 84578776
N-(4-sulfamoylphenyl)imidazo[1,5-a]pyridine-7-carboxamide (PubChem CID 84578776) has the molecular formula C14H12N4O3S and a molecular weight of 316.34 g/mol. Its IUPAC name is N-(4-sulfamoylphenyl)imidazo[1,5-a]pyridine-7-carboxamide.
| Compound Name | N-(4-sulfamoylphenyl)imidazo[1,5-a]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 84578776 |
| Molecular Formula | C14H12N4O3S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | N-(4-sulfamoylphenyl)imidazo[1,5-a]pyridine-7-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)c2ccn3cncc3c2)cc1 |
| InChI | InChI=1S/C14H12N4O3S/c15-22(20,21)13-3-1-11(2-4-13)17-14(19)10-5-6-18-9-16-8-12(18)7-10/h1-9H,(H,17,19)(H2,15,20,21) |
| InChIKey | ZJKZSJYIOSNDQQ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |