C14H11N3O4S — CID 108795105
N-(4-sulfamoylphenyl)-1,3-benzoxazole-5-carboxamide (PubChem CID 108795105) has the molecular formula C14H11N3O4S and a molecular weight of 317.33 g/mol. Its IUPAC name is N-(4-sulfamoylphenyl)-1,3-benzoxazole-5-carboxamide.
| Compound Name | N-(4-sulfamoylphenyl)-1,3-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 108795105 |
| Molecular Formula | C14H11N3O4S |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | N-(4-sulfamoylphenyl)-1,3-benzoxazole-5-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)c2ccc3ocnc3c2)cc1 |
| InChI | InChI=1S/C14H11N3O4S/c15-22(19,20)11-4-2-10(3-5-11)17-14(18)9-1-6-13-12(7-9)16-8-21-13/h1-8H,(H,17,18)(H2,15,19,20) |
| InChIKey | DRUJRNZAHQFPRK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |