C12H17ClN2 — CID 84624812
7-chloro-2-ethyl-4,5-dimethyl-2,3-dihydro-1H-quinoxaline (PubChem CID 84624812) has the molecular formula C12H17ClN2 and a molecular weight of 224.73 g/mol. Its IUPAC name is 7-chloro-2-ethyl-4,5-dimethyl-2,3-dihydro-1H-quinoxaline.
| Compound Name | 7-chloro-2-ethyl-4,5-dimethyl-2,3-dihydro-1H-quinoxaline |
|---|---|
| PubChem CID | 84624812 |
| Molecular Formula | C12H17ClN2 |
| Molecular Weight | 224.73 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 7-chloro-2-ethyl-4,5-dimethyl-2,3-dihydro-1H-quinoxaline |
| SMILES | CCC1CN(C)c2c(C)cc(Cl)cc2N1 |
| InChI | InChI=1S/C12H17ClN2/c1-4-10-7-15(3)12-8(2)5-9(13)6-11(12)14-10/h5-6,10,14H,4,7H2,1-3H3 |
| InChIKey | VNIYAIFXRFAIDX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.73 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |