C8H15NS — CID 84650655
1-(3,6-dihydro-2H-thiopyran-4-yl)propan-2-amine (PubChem CID 84650655) has the molecular formula C8H15NS and a molecular weight of 157.28 g/mol. Its IUPAC name is 1-(3,6-dihydro-2H-thiopyran-4-yl)propan-2-amine.
| Compound Name | 1-(3,6-dihydro-2H-thiopyran-4-yl)propan-2-amine |
|---|---|
| PubChem CID | 84650655 |
| Molecular Formula | C8H15NS |
| Molecular Weight | 157.28 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 1-(3,6-dihydro-2H-thiopyran-4-yl)propan-2-amine |
| SMILES | CC(N)CC1=CCSCC1 |
| InChI | InChI=1S/C8H15NS/c1-7(9)6-8-2-4-10-5-3-8/h2,7H,3-6,9H2,1H3 |
| InChIKey | DCQYSNRCMFIFNS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.28 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|