C9H9ClN2 — CID 84657667
7-chloro-1,2-dimethylpyrrolo[3,2-b]pyridine (PubChem CID 84657667) has the molecular formula C9H9ClN2 and a molecular weight of 180.64 g/mol. Its IUPAC name is 7-chloro-1,2-dimethylpyrrolo[3,2-b]pyridine.
| Compound Name | 7-chloro-1,2-dimethylpyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 84657667 |
| Molecular Formula | C9H9ClN2 |
| Molecular Weight | 180.64 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 7-chloro-1,2-dimethylpyrrolo[3,2-b]pyridine |
| SMILES | Cc1cc2nccc(Cl)c2n1C |
| InChI | InChI=1S/C9H9ClN2/c1-6-5-8-9(12(6)2)7(10)3-4-11-8/h3-5H,1-2H3 |
| InChIKey | YPGUXWHSYCBRLW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.64 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |