4,4-difluoro-3-methyl-1,1-dioxothiane-3-carboxylic acid

C7H10F2O4S — CID 84792117

IUPAC4,4-difluoro-3-methyl-1,1-dioxothiane-3-carboxylic acid
SMILESCC1(C(=O)O)CS(=O)(=O)CCC1(F)F
InChIInChI=1S/C7H10F2O4S/c1-6(5(10)11)4-14(12,13)3-2-7(6,8)9/h2-4H2,1H3,(H,10,11)
InChIKeyNYIXUQYCUFSHSQ-UHFFFAOYSA-N
MW228.22 g/mol
LogP0.53
Rot. Bonds1

About 4,4-difluoro-3-methyl-1,1-dioxothiane-3-carboxylic acid

4,4-difluoro-3-methyl-1,1-dioxothiane-3-carboxylic acid (PubChem CID 84792117) has the molecular formula C7H10F2O4S and a molecular weight of 228.22 g/mol. Its IUPAC name is 4,4-difluoro-3-methyl-1,1-dioxothiane-3-carboxylic acid.

Molecular Properties

Compound Name4,4-difluoro-3-methyl-1,1-dioxothiane-3-carboxylic acid
PubChem CID84792117
Molecular FormulaC7H10F2O4S
Molecular Weight228.22 g/mol
Exact Mass228.03
IUPAC Name4,4-difluoro-3-methyl-1,1-dioxothiane-3-carboxylic acid
SMILESCC1(C(=O)O)CS(=O)(=O)CCC1(F)F
InChIInChI=1S/C7H10F2O4S/c1-6(5(10)11)4-14(12,13)3-2-7(6,8)9/h2-4H2,1H3,(H,10,11)
InChIKeyNYIXUQYCUFSHSQ-UHFFFAOYSA-N
XLogP0.53
TPSA71.44 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.22
LogP ≤ 50.53
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4,4-difluoro-3-methyl-1,1-dioxothiane-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4,4-difluoro-3-methyl-1,1-dioxothiane-3-carboxylic acid?
The IUPAC name of 4,4-difluoro-3-methyl-1,1-dioxothiane-3-carboxylic acid (CID 84792117) is 4,4-difluoro-3-methyl-1,1-dioxothiane-3-carboxylic acid.
What is the SMILES notation for 4,4-difluoro-3-methyl-1,1-dioxothiane-3-carboxylic acid?
The canonical SMILES for 4,4-difluoro-3-methyl-1,1-dioxothiane-3-carboxylic acid is CC1(C(=O)O)CS(=O)(=O)CCC1(F)F.
What is the InChIKey of 4,4-difluoro-3-methyl-1,1-dioxothiane-3-carboxylic acid?
The InChIKey is NYIXUQYCUFSHSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10F2O4S/c1-6(5(10)11)4-14(12,13)3-2-7(6,8)9/h2-4H2,1H3,(H,10,11).
What are the key properties of 4,4-difluoro-3-methyl-1,1-dioxothiane-3-carboxylic acid?
4,4-difluoro-3-methyl-1,1-dioxothiane-3-carboxylic acid has a molecular weight of 228.22 g/mol, XLogP of 0.53, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-difluoro-3-methyl-1,1-dioxothiane-3-carboxylic acid is sourced from PubChem (CID 84792117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).