C8H12F2O4S — CID 84801615
3-ethyl-4,4-difluoro-1,1-dioxothiane-3-carboxylic acid (PubChem CID 84801615) has the molecular formula C8H12F2O4S and a molecular weight of 242.24 g/mol. Its IUPAC name is 3-ethyl-4,4-difluoro-1,1-dioxothiane-3-carboxylic acid.
| Compound Name | 3-ethyl-4,4-difluoro-1,1-dioxothiane-3-carboxylic acid |
|---|---|
| PubChem CID | 84801615 |
| Molecular Formula | C8H12F2O4S |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 3-ethyl-4,4-difluoro-1,1-dioxothiane-3-carboxylic acid |
| SMILES | CCC1(C(=O)O)CS(=O)(=O)CCC1(F)F |
| InChI | InChI=1S/C8H12F2O4S/c1-2-7(6(11)12)5-15(13,14)4-3-8(7,9)10/h2-5H2,1H3,(H,11,12) |
| InChIKey | MTTZCBIFDBJYEE-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |