C36H33NO7S — CID 85392515
[5-(1,3-dioxoisoindol-2-yl)-4-phenylmethoxy-2-(phenylmethoxymethyl)-6-phenylsulfanyloxan-3-yl] acetate (PubChem CID 85392515) has the molecular formula C36H33NO7S and a molecular weight of 623.73 g/mol. Its IUPAC name is [5-(1,3-dioxoisoindol-2-yl)-4-phenylmethoxy-2-(phenylmethoxymethyl)-6-phenylsulfanyloxan-3-yl] acetate.
| Compound Name | [5-(1,3-dioxoisoindol-2-yl)-4-phenylmethoxy-2-(phenylmethoxymethyl)-6-phenylsulfanyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 85392515 |
| Molecular Formula | C36H33NO7S |
| Molecular Weight | 623.73 g/mol |
| Exact Mass | 623.20 |
| IUPAC Name | [5-(1,3-dioxoisoindol-2-yl)-4-phenylmethoxy-2-(phenylmethoxymethyl)-6-phenylsulfanyloxan-3-yl] acetate |
| SMILES | CC(=O)OC1C(COCc2ccccc2)OC(Sc2ccccc2)C(N2C(=O)c3ccccc3C2=O)C1OCc1ccccc1 |
| InChI | InChI=1S/C36H33NO7S/c1-24(38)43-32-30(23-41-21-25-13-5-2-6-14-25)44-36(45-27-17-9-4-10-18-27)31(33(32)42-22-26-15-7-3-8-16-26)37-34(39)28-19-11-12-20-29(28)35(37)40/h2-20,30-33,36H,21-23H2,1H3 |
| InChIKey | XIMVSPISESOFAN-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.73 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|