C9H14ClN5 — CID 85468707
[amino-(diaminomethylideneamino)methylidene]-benzylazanium chloride (PubChem CID 85468707) has the molecular formula C9H14ClN5 and a molecular weight of 227.70 g/mol. Its IUPAC name is [amino-(diaminomethylideneamino)methylidene]-benzylazanium chloride.
| Compound Name | [amino-(diaminomethylideneamino)methylidene]-benzylazanium chloride |
|---|---|
| PubChem CID | 85468707 |
| Molecular Formula | C9H14ClN5 |
| Molecular Weight | 227.70 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | [amino-(diaminomethylideneamino)methylidene]-benzylazanium chloride |
| SMILES | NC(N)=N/C(N)=[NH+]/Cc1ccccc1.[Cl-] |
| InChI | InChI=1S/C9H13N5.ClH/c10-8(11)14-9(12)13-6-7-4-2-1-3-5-7;/h1-5H,6H2,(H6,10,11,12,13,14);1H |
| InChIKey | AQJYNUYNAIBZPG-UHFFFAOYSA-N |
| XLogP | -5.14 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.70 |
| LogP ≤ 5 | -5.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|