C24H34S2 — CID 86094002
1-tert-butyl-4-[(4-tert-butyl-2,5-dimethylphenyl)disulfanyl]-2,5-dimethylbenzene (PubChem CID 86094002) has the molecular formula C24H34S2 and a molecular weight of 386.67 g/mol. Its IUPAC name is 1-tert-butyl-4-[(4-tert-butyl-2,5-dimethylphenyl)disulfanyl]-2,5-dimethylbenzene.
| Compound Name | 1-tert-butyl-4-[(4-tert-butyl-2,5-dimethylphenyl)disulfanyl]-2,5-dimethylbenzene |
|---|---|
| PubChem CID | 86094002 |
| Molecular Formula | C24H34S2 |
| Molecular Weight | 386.67 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 1-tert-butyl-4-[(4-tert-butyl-2,5-dimethylphenyl)disulfanyl]-2,5-dimethylbenzene |
| SMILES | Cc1cc(C(C)(C)C)c(C)cc1SSc1cc(C)c(C(C)(C)C)cc1C |
| InChI | InChI=1S/C24H34S2/c1-15-13-21(17(3)11-19(15)23(5,6)7)25-26-22-14-16(2)20(12-18(22)4)24(8,9)10/h11-14H,1-10H3 |
| InChIKey | DTAZFOYOPODJJZ-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.67 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|