C17H25NO2S — CID 86098497
4-methyl-N-(2-methylnona-3,4-dienyl)benzenesulfonamide (PubChem CID 86098497) has the molecular formula C17H25NO2S and a molecular weight of 307.46 g/mol. Its IUPAC name is 4-methyl-N-(2-methylnona-3,4-dienyl)benzenesulfonamide.
| Compound Name | 4-methyl-N-(2-methylnona-3,4-dienyl)benzenesulfonamide |
|---|---|
| PubChem CID | 86098497 |
| Molecular Formula | C17H25NO2S |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 4-methyl-N-(2-methylnona-3,4-dienyl)benzenesulfonamide |
| SMILES | CCCCC=C=CC(C)CNS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H25NO2S/c1-4-5-6-7-8-9-16(3)14-18-21(19,20)17-12-10-15(2)11-13-17/h7,9-13,16,18H,4-6,14H2,1-3H3 |
| InChIKey | SSIULABKUMWDTN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|