C16H23NO2S — CID 170102517
4-methyl-N-[(3Z,5Z)-2-methylocta-3,5-dienyl]benzenesulfonamide (PubChem CID 170102517) has the molecular formula C16H23NO2S and a molecular weight of 293.43 g/mol. Its IUPAC name is 4-methyl-N-[(3Z,5Z)-2-methylocta-3,5-dienyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[(3Z,5Z)-2-methylocta-3,5-dienyl]benzenesulfonamide |
|---|---|
| PubChem CID | 170102517 |
| Molecular Formula | C16H23NO2S |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 4-methyl-N-[(3Z,5Z)-2-methylocta-3,5-dienyl]benzenesulfonamide |
| SMILES | CC/C=C\C=C/C(C)CNS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H23NO2S/c1-4-5-6-7-8-15(3)13-17-20(18,19)16-11-9-14(2)10-12-16/h5-12,15,17H,4,13H2,1-3H3/b6-5-,8-7- |
| InChIKey | OGFFSJQQKRLEBS-ISTTXYCBSA-N |
| XLogP | 3.43 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|