About [1-(1,3,2-dioxaborinan-2-yl)-5-methylhexyl]-trimethylsilane
[1-(1,3,2-dioxaborinan-2-yl)-5-methylhexyl]-trimethylsilane (PubChem CID 86236913) has the molecular formula C13H29BO2Si
and a molecular weight of 256.27 g/mol. Its IUPAC name is [1-(1,3,2-dioxaborinan-2-yl)-5-methylhexyl]-trimethylsilane.
Molecular Properties
| Compound Name | [1-(1,3,2-dioxaborinan-2-yl)-5-methylhexyl]-trimethylsilane |
| PubChem CID | 86236913 |
| Molecular Formula | C13H29BO2Si |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | [1-(1,3,2-dioxaborinan-2-yl)-5-methylhexyl]-trimethylsilane |
| SMILES | CC(C)CCCC(B1OCCCO1)[Si](C)(C)C |
| InChI | InChI=1S/C13H29BO2Si/c1-12(2)8-6-9-13(17(3,4)5)14-15-10-7-11-16-14/h12-13H,6-11H2,1-5H3 |
| InChIKey | CYCAPGOKLPCDQW-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [1-(1,3,2-dioxaborinan-2-yl)-5-methylhexyl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(1,3,2-dioxaborinan-2-yl)-5-methylhexyl]-trimethylsilane?
The IUPAC name of [1-(1,3,2-dioxaborinan-2-yl)-5-methylhexyl]-trimethylsilane (CID 86236913) is [1-(1,3,2-dioxaborinan-2-yl)-5-methylhexyl]-trimethylsilane.
What is the SMILES notation for [1-(1,3,2-dioxaborinan-2-yl)-5-methylhexyl]-trimethylsilane?
The canonical SMILES for [1-(1,3,2-dioxaborinan-2-yl)-5-methylhexyl]-trimethylsilane is CC(C)CCCC(B1OCCCO1)[Si](C)(C)C.
What is the InChIKey of [1-(1,3,2-dioxaborinan-2-yl)-5-methylhexyl]-trimethylsilane?
The InChIKey is CYCAPGOKLPCDQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29BO2Si/c1-12(2)8-6-9-13(17(3,4)5)14-15-10-7-11-16-14/h12-13H,6-11H2,1-5H3.
What are the key properties of [1-(1,3,2-dioxaborinan-2-yl)-5-methylhexyl]-trimethylsilane?
[1-(1,3,2-dioxaborinan-2-yl)-5-methylhexyl]-trimethylsilane has a molecular weight of 256.27 g/mol, XLogP of 3.99, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(1,3,2-dioxaborinan-2-yl)-5-methylhexyl]-trimethylsilane is sourced from PubChem (CID 86236913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).