C13H29BO2Si — CID 86236913
[1-(1,3,2-dioxaborinan-2-yl)-5-methylhexyl]-trimethylsilane (PubChem CID 86236913) has the molecular formula C13H29BO2Si and a molecular weight of 256.27 g/mol. Its IUPAC name is [1-(1,3,2-dioxaborinan-2-yl)-5-methylhexyl]-trimethylsilane.
| Compound Name | [1-(1,3,2-dioxaborinan-2-yl)-5-methylhexyl]-trimethylsilane |
|---|---|
| PubChem CID | 86236913 |
| Molecular Formula | C13H29BO2Si |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | [1-(1,3,2-dioxaborinan-2-yl)-5-methylhexyl]-trimethylsilane |
| SMILES | CC(C)CCCC(B1OCCCO1)[Si](C)(C)C |
| InChI | InChI=1S/C13H29BO2Si/c1-12(2)8-6-9-13(17(3,4)5)14-15-10-7-11-16-14/h12-13H,6-11H2,1-5H3 |
| InChIKey | CYCAPGOKLPCDQW-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|