C11H10ClNO — CID 86290450
6-(4-chlorophenyl)-2,3-dihydro-1H-pyridin-4-one (PubChem CID 86290450) has the molecular formula C11H10ClNO and a molecular weight of 207.66 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-2,3-dihydro-1H-pyridin-4-one.
| Compound Name | 6-(4-chlorophenyl)-2,3-dihydro-1H-pyridin-4-one |
|---|---|
| PubChem CID | 86290450 |
| Molecular Formula | C11H10ClNO |
| Molecular Weight | 207.66 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 6-(4-chlorophenyl)-2,3-dihydro-1H-pyridin-4-one |
| SMILES | O=C1C=C(c2ccc(Cl)cc2)NCC1 |
| InChI | InChI=1S/C11H10ClNO/c12-9-3-1-8(2-4-9)11-7-10(14)5-6-13-11/h1-4,7,13H,5-6H2 |
| InChIKey | VCPGJCDIFMPATH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.66 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |