C9H9ClN2 — CID 13143700
3-(4-chlorophenyl)-4,5-dihydro-1H-pyrazole (PubChem CID 13143700) has the molecular formula C9H9ClN2 and a molecular weight of 180.64 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-4,5-dihydro-1H-pyrazole.
| Compound Name | 3-(4-chlorophenyl)-4,5-dihydro-1H-pyrazole |
|---|---|
| PubChem CID | 13143700 |
| Molecular Formula | C9H9ClN2 |
| Molecular Weight | 180.64 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 3-(4-chlorophenyl)-4,5-dihydro-1H-pyrazole |
| SMILES | Clc1ccc(C2=NNCC2)cc1 |
| InChI | InChI=1S/C9H9ClN2/c10-8-3-1-7(2-4-8)9-5-6-11-12-9/h1-4,11H,5-6H2 |
| InChIKey | MNNBRTOCZDFZQP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.64 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |