C16H12N2O5S — CID 86291618
(2Z)-3-hydroxy-2-(2-oxo-1H-indol-3-ylidene)-3H-indole-1-sulfonic acid (PubChem CID 86291618) has the molecular formula C16H12N2O5S and a molecular weight of 344.35 g/mol. Its IUPAC name is (2Z)-3-hydroxy-2-(2-oxo-1H-indol-3-ylidene)-3H-indole-1-sulfonic acid.
| Compound Name | (2Z)-3-hydroxy-2-(2-oxo-1H-indol-3-ylidene)-3H-indole-1-sulfonic acid |
|---|---|
| PubChem CID | 86291618 |
| Molecular Formula | C16H12N2O5S |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | (2Z)-3-hydroxy-2-(2-oxo-1H-indol-3-ylidene)-3H-indole-1-sulfonic acid |
| SMILES | O=C1Nc2ccccc2/C1=C1\C(O)c2ccccc2N1S(=O)(=O)O |
| InChI | InChI=1S/C16H12N2O5S/c19-15-10-6-2-4-8-12(10)18(24(21,22)23)14(15)13-9-5-1-3-7-11(9)17-16(13)20/h1-8,15,19H,(H,17,20)(H,21,22,23)/b14-13- |
| InChIKey | HJVOMDFCIJXHIS-YPKPFQOOSA-N |
| XLogP | 1.71 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|