C22H22N2O6S — CID 86292621
3-[(2Z)-3-hydroxy-2-(5-hydroxy-2-oxo-1H-indol-3-ylidene)-3H-indol-1-yl]-1-methylcyclopentane-1-sulfonic acid (PubChem CID 86292621) has the molecular formula C22H22N2O6S and a molecular weight of 442.49 g/mol. Its IUPAC name is 3-[(2Z)-3-hydroxy-2-(5-hydroxy-2-oxo-1H-indol-3-ylidene)-3H-indol-1-yl]-1-methylcyclopentane-1-sulfonic acid.
| Compound Name | 3-[(2Z)-3-hydroxy-2-(5-hydroxy-2-oxo-1H-indol-3-ylidene)-3H-indol-1-yl]-1-methylcyclopentane-1-sulfonic acid |
|---|---|
| PubChem CID | 86292621 |
| Molecular Formula | C22H22N2O6S |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 3-[(2Z)-3-hydroxy-2-(5-hydroxy-2-oxo-1H-indol-3-ylidene)-3H-indol-1-yl]-1-methylcyclopentane-1-sulfonic acid |
| SMILES | CC1(S(=O)(=O)O)CCC(N2/C(=C3\C(=O)Nc4ccc(O)cc43)C(O)c3ccccc32)C1 |
| InChI | InChI=1S/C22H22N2O6S/c1-22(31(28,29)30)9-8-12(11-22)24-17-5-3-2-4-14(17)20(26)19(24)18-15-10-13(25)6-7-16(15)23-21(18)27/h2-7,10,12,20,25-26H,8-9,11H2,1H3,(H,23,27)(H,28,29,30)/b19-18- |
| InChIKey | RVBHZOSKGXONDG-HNENSFHCSA-N |
| XLogP | 2.81 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|