C8H14ClNOS — CID 86300737
1-chloro-3-(2,2-dimethyl-1,3-thiazolidin-3-yl)propan-2-one (PubChem CID 86300737) has the molecular formula C8H14ClNOS and a molecular weight of 207.73 g/mol. Its IUPAC name is 1-chloro-3-(2,2-dimethyl-1,3-thiazolidin-3-yl)propan-2-one.
| Compound Name | 1-chloro-3-(2,2-dimethyl-1,3-thiazolidin-3-yl)propan-2-one |
|---|---|
| PubChem CID | 86300737 |
| Molecular Formula | C8H14ClNOS |
| Molecular Weight | 207.73 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 1-chloro-3-(2,2-dimethyl-1,3-thiazolidin-3-yl)propan-2-one |
| SMILES | CC1(C)SCCN1CC(=O)CCl |
| InChI | InChI=1S/C8H14ClNOS/c1-8(2)10(3-4-12-8)6-7(11)5-9/h3-6H2,1-2H3 |
| InChIKey | IUMQXYDWZMYXCZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.73 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|