C6H3N2O2S- — CID 86307714
7-oxo-6H-thieno[2,3-d]pyridazin-4-olate (PubChem CID 86307714) has the molecular formula C6H3N2O2S- and a molecular weight of 167.17 g/mol. Its IUPAC name is 7-oxo-6H-thieno[2,3-d]pyridazin-4-olate.
| Compound Name | 7-oxo-6H-thieno[2,3-d]pyridazin-4-olate |
|---|---|
| PubChem CID | 86307714 |
| Molecular Formula | C6H3N2O2S- |
| Molecular Weight | 167.17 g/mol |
| Exact Mass | 166.99 |
| IUPAC Name | 7-oxo-6H-thieno[2,3-d]pyridazin-4-olate |
| SMILES | O=c1[nH]nc([O-])c2ccsc12 |
| InChI | InChI=1S/C6H4N2O2S/c9-5-3-1-2-11-4(3)6(10)8-7-5/h1-2H,(H,7,9)(H,8,10)/p-1 |
| InChIKey | KWBNTVHZVCVOAV-UHFFFAOYSA-M |
| XLogP | 0.06 |
| TPSA | 68.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.17 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |