C6H12FN — CID 86333919
cis-(1R,3S)-3-fluorocyclohexan-1-amine (PubChem CID 86333919) has the molecular formula C6H12FN and a molecular weight of 117.17 g/mol. Its IUPAC name is cis-(1R,3S)-3-fluorocyclohexan-1-amine.
| Compound Name | cis-(1R,3S)-3-fluorocyclohexan-1-amine |
|---|---|
| PubChem CID | 86333919 |
| Molecular Formula | C6H12FN |
| Molecular Weight | 117.17 g/mol |
| Exact Mass | 117.10 |
| IUPAC Name | cis-(1R,3S)-3-fluorocyclohexan-1-amine |
| SMILES | N[C@@H]1CCC[C@H](F)C1 |
| InChI | InChI=1S/C6H12FN/c7-5-2-1-3-6(8)4-5/h5-6H,1-4,8H2/t5-,6+/m0/s1 |
| InChIKey | ZPZKJQKFLQCCMD-NTSWFWBYSA-N |
| XLogP | 1.23 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 117.17 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |