C18H13BrF2O3 — CID 86338357
methyl (2R)-2-(8-bromo-1,3-difluorophenanthren-2-yl)-2-hydroxypropanoate (PubChem CID 86338357) has the molecular formula C18H13BrF2O3 and a molecular weight of 395.20 g/mol. Its IUPAC name is methyl (2R)-2-(8-bromo-1,3-difluorophenanthren-2-yl)-2-hydroxypropanoate.
| Compound Name | methyl (2R)-2-(8-bromo-1,3-difluorophenanthren-2-yl)-2-hydroxypropanoate |
|---|---|
| PubChem CID | 86338357 |
| Molecular Formula | C18H13BrF2O3 |
| Molecular Weight | 395.20 g/mol |
| Exact Mass | 394.00 |
| IUPAC Name | methyl (2R)-2-(8-bromo-1,3-difluorophenanthren-2-yl)-2-hydroxypropanoate |
| SMILES | COC(=O)[C@](C)(O)c1c(F)cc2c(ccc3c(Br)cccc32)c1F |
| InChI | InChI=1S/C18H13BrF2O3/c1-18(23,17(22)24-2)15-14(20)8-12-9-4-3-5-13(19)10(9)6-7-11(12)16(15)21/h3-8,23H,1-2H3/t18-/m1/s1 |
| InChIKey | PUEMYJMGVOVIMD-GOSISDBHSA-N |
| XLogP | 4.41 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.20 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|