C7H12N2O — CID 86341003
(2-amino-4-methyl-1,2-dihydropyridin-3-yl)methanol (PubChem CID 86341003) has the molecular formula C7H12N2O and a molecular weight of 140.19 g/mol. Its IUPAC name is (2-amino-4-methyl-1,2-dihydropyridin-3-yl)methanol.
| Compound Name | (2-amino-4-methyl-1,2-dihydropyridin-3-yl)methanol |
|---|---|
| PubChem CID | 86341003 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | (2-amino-4-methyl-1,2-dihydropyridin-3-yl)methanol |
| SMILES | CC1=C(CO)C(N)NC=C1 |
| InChI | InChI=1S/C7H12N2O/c1-5-2-3-9-7(8)6(5)4-10/h2-3,7,9-10H,4,8H2,1H3 |
| InChIKey | JOBHIJYZJDXRME-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |