About [2-(dimethylamino)-1,2-dihydropyridin-3-yl]methanol
[2-(dimethylamino)-1,2-dihydropyridin-3-yl]methanol (PubChem CID 86341008) has the molecular formula C8H14N2O
and a molecular weight of 154.21 g/mol. Its IUPAC name is [2-(dimethylamino)-1,2-dihydropyridin-3-yl]methanol.
Analyze [2-(dimethylamino)-1,2-dihydropyridin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(dimethylamino)-1,2-dihydropyridin-3-yl]methanol?
The IUPAC name of [2-(dimethylamino)-1,2-dihydropyridin-3-yl]methanol (CID 86341008) is [2-(dimethylamino)-1,2-dihydropyridin-3-yl]methanol.
What is the SMILES notation for [2-(dimethylamino)-1,2-dihydropyridin-3-yl]methanol?
The canonical SMILES for [2-(dimethylamino)-1,2-dihydropyridin-3-yl]methanol is CN(C)C1NC=CC=C1CO.
What is the InChIKey of [2-(dimethylamino)-1,2-dihydropyridin-3-yl]methanol?
The InChIKey is AYENVSNYEBLGJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O/c1-10(2)8-7(6-11)4-3-5-9-8/h3-5,8-9,11H,6H2,1-2H3.
What are the key properties of [2-(dimethylamino)-1,2-dihydropyridin-3-yl]methanol?
[2-(dimethylamino)-1,2-dihydropyridin-3-yl]methanol has a molecular weight of 154.21 g/mol, XLogP of -0.09, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(dimethylamino)-1,2-dihydropyridin-3-yl]methanol is sourced from PubChem (CID 86341008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).