C27H29ClN4O2 — CID 86576849
1-[5-[4-(7-chloroquinolin-4-yl)piperazin-1-yl]pentyl]-5-methylindole-2,3-dione (PubChem CID 86576849) has the molecular formula C27H29ClN4O2 and a molecular weight of 477.01 g/mol. Its IUPAC name is 1-[5-[4-(7-chloroquinolin-4-yl)piperazin-1-yl]pentyl]-5-methylindole-2,3-dione.
| Compound Name | 1-[5-[4-(7-chloroquinolin-4-yl)piperazin-1-yl]pentyl]-5-methylindole-2,3-dione |
|---|---|
| PubChem CID | 86576849 |
| Molecular Formula | C27H29ClN4O2 |
| Molecular Weight | 477.01 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | 1-[5-[4-(7-chloroquinolin-4-yl)piperazin-1-yl]pentyl]-5-methylindole-2,3-dione |
| SMILES | Cc1ccc2c(c1)C(=O)C(=O)N2CCCCCN1CCN(c2ccnc3cc(Cl)ccc23)CC1 |
| InChI | InChI=1S/C27H29ClN4O2/c1-19-5-8-25-22(17-19)26(33)27(34)32(25)12-4-2-3-11-30-13-15-31(16-14-30)24-9-10-29-23-18-20(28)6-7-21(23)24/h5-10,17-18H,2-4,11-16H2,1H3 |
| InChIKey | GXGWAXCTVRGDPU-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.01 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|