C20H26FN5O9 — CID 86588306
nitric acid;4-nitrooxybutyl 1-ethyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylate (PubChem CID 86588306) has the molecular formula C20H26FN5O9 and a molecular weight of 499.45 g/mol. Its IUPAC name is nitric acid;4-nitrooxybutyl 1-ethyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylate.
| Compound Name | nitric acid;4-nitrooxybutyl 1-ethyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 86588306 |
| Molecular Formula | C20H26FN5O9 |
| Molecular Weight | 499.45 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | nitric acid;4-nitrooxybutyl 1-ethyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylate |
| SMILES | CCn1cc(C(=O)OCCCCO[N+](=O)[O-])c(=O)c2cc(F)c(N3CCNCC3)cc21.O=[N+]([O-])O |
| InChI | InChI=1S/C20H25FN4O6.HNO3/c1-2-23-13-15(20(27)30-9-3-4-10-31-25(28)29)19(26)14-11-16(21)18(12-17(14)23)24-7-5-22-6-8-24;2-1(3)4/h11-13,22H,2-10H2,1H3;(H,2,3,4) |
| InChIKey | CRQGQQICZADIRV-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 179.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.45 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|