C18H21N5O2 — CID 86591127
5-amino-N-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]quinoline-2-carboxamide (PubChem CID 86591127) has the molecular formula C18H21N5O2 and a molecular weight of 339.40 g/mol. Its IUPAC name is 5-amino-N-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]quinoline-2-carboxamide.
| Compound Name | 5-amino-N-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 86591127 |
| Molecular Formula | C18H21N5O2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 5-amino-N-[1-(cyanomethylamino)-4-methyl-1-oxopentan-2-yl]quinoline-2-carboxamide |
| SMILES | CC(C)CC(NC(=O)c1ccc2c(N)cccc2n1)C(=O)NCC#N |
| InChI | InChI=1S/C18H21N5O2/c1-11(2)10-16(17(24)21-9-8-19)23-18(25)15-7-6-12-13(20)4-3-5-14(12)22-15/h3-7,11,16H,9-10,20H2,1-2H3,(H,21,24)(H,23,25) |
| InChIKey | SSQQEDTWFQTNIE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 120.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|