C19H21ClO7S2 — CID 86592570
2-(4-methylphenyl)sulfonylethyl 3-(5-chlorosulfonyl-2-methoxyphenyl)propanoate (PubChem CID 86592570) has the molecular formula C19H21ClO7S2 and a molecular weight of 460.96 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfonylethyl 3-(5-chlorosulfonyl-2-methoxyphenyl)propanoate.
| Compound Name | 2-(4-methylphenyl)sulfonylethyl 3-(5-chlorosulfonyl-2-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 86592570 |
| Molecular Formula | C19H21ClO7S2 |
| Molecular Weight | 460.96 g/mol |
| Exact Mass | 460.04 |
| IUPAC Name | 2-(4-methylphenyl)sulfonylethyl 3-(5-chlorosulfonyl-2-methoxyphenyl)propanoate |
| SMILES | COc1ccc(S(=O)(=O)Cl)cc1CCC(=O)OCCS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H21ClO7S2/c1-14-3-6-16(7-4-14)28(22,23)12-11-27-19(21)10-5-15-13-17(29(20,24)25)8-9-18(15)26-2/h3-4,6-9,13H,5,10-12H2,1-2H3 |
| InChIKey | LGKJSFOWSNNJIY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.96 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |