C15H25F4N3O3 — CID 86596622
tert-butyl N-[(2S)-6-amino-1-oxo-1-(3,3,4,4-tetrafluoropyrrolidin-1-yl)hexan-2-yl]carbamate (PubChem CID 86596622) has the molecular formula C15H25F4N3O3 and a molecular weight of 371.38 g/mol. Its IUPAC name is tert-butyl N-[(2S)-6-amino-1-oxo-1-(3,3,4,4-tetrafluoropyrrolidin-1-yl)hexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-6-amino-1-oxo-1-(3,3,4,4-tetrafluoropyrrolidin-1-yl)hexan-2-yl]carbamate |
|---|---|
| PubChem CID | 86596622 |
| Molecular Formula | C15H25F4N3O3 |
| Molecular Weight | 371.38 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | tert-butyl N-[(2S)-6-amino-1-oxo-1-(3,3,4,4-tetrafluoropyrrolidin-1-yl)hexan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCCN)C(=O)N1CC(F)(F)C(F)(F)C1 |
| InChI | InChI=1S/C15H25F4N3O3/c1-13(2,3)25-12(24)21-10(6-4-5-7-20)11(23)22-8-14(16,17)15(18,19)9-22/h10H,4-9,20H2,1-3H3,(H,21,24)/t10-/m0/s1 |
| InChIKey | MTLXBIGZTDGXCC-JTQLQIEISA-N |
| XLogP | 2.12 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|