C29H36INO4 — CID 86600283
(4R,4aS,7aR,12bR)-7a-benzyl-4a-butoxy-9-hydroxy-3,3-dimethyl-1,2,4,5,6,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one iodide (PubChem CID 86600283) has the molecular formula C29H36INO4 and a molecular weight of 589.51 g/mol. Its IUPAC name is (4R,4aS,7aR,12bR)-7a-benzyl-4a-butoxy-9-hydroxy-3,3-dimethyl-1,2,4,5,6,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one iodide.
| Compound Name | (4R,4aS,7aR,12bR)-7a-benzyl-4a-butoxy-9-hydroxy-3,3-dimethyl-1,2,4,5,6,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one iodide |
|---|---|
| PubChem CID | 86600283 |
| Molecular Formula | C29H36INO4 |
| Molecular Weight | 589.51 g/mol |
| Exact Mass | 589.17 |
| IUPAC Name | (4R,4aS,7aR,12bR)-7a-benzyl-4a-butoxy-9-hydroxy-3,3-dimethyl-1,2,4,5,6,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one iodide |
| SMILES | CCCCO[C@@]12CCC(=O)[C@]3(Cc4ccccc4)Oc4c(O)ccc5c4[C@@]31CC[N+](C)(C)[C@@H]2C5.[I-] |
| InChI | InChI=1S/C29H35NO4.HI/c1-4-5-17-33-28-14-13-24(32)29(19-20-9-7-6-8-10-20)27(28)15-16-30(2,3)23(28)18-21-11-12-22(31)26(34-29)25(21)27;/h6-12,23H,4-5,13-19H2,1-3H3;1H/t23-,27-,28-,29+;/m1./s1 |
| InChIKey | OIMTXHNTCNUMHR-BYORIIFBSA-N |
| XLogP | 1.33 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.51 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|