C28H32ClN3O3S — CID 86601022
N-[2-[(4-chlorophenyl)carbamothioylamino]ethyl]-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-2-methylpropanamide (PubChem CID 86601022) has the molecular formula C28H32ClN3O3S and a molecular weight of 526.10 g/mol. Its IUPAC name is N-[2-[(4-chlorophenyl)carbamothioylamino]ethyl]-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-2-methylpropanamide.
| Compound Name | N-[2-[(4-chlorophenyl)carbamothioylamino]ethyl]-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 86601022 |
| Molecular Formula | C28H32ClN3O3S |
| Molecular Weight | 526.10 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | N-[2-[(4-chlorophenyl)carbamothioylamino]ethyl]-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]-2-methylpropanamide |
| SMILES | COc1cc(CN(CCNC(=S)Nc2ccc(Cl)cc2)C(=O)C(C)C)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C28H32ClN3O3S/c1-20(2)27(33)32(16-15-30-28(36)31-24-12-10-23(29)11-13-24)18-22-9-14-25(26(17-22)34-3)35-19-21-7-5-4-6-8-21/h4-14,17,20H,15-16,18-19H2,1-3H3,(H2,30,31,36) |
| InChIKey | WDTAMULYYLJIMI-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.10 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|