C26H37N3O4SSi2 — CID 86606905
4-amino-5-[1,4-bis(trimethylsilyl)but-1-en-3-ynyl]-6-ethoxy-N-[(4-methylsulfonylphenyl)methyl]pyridine-2-carboxamide (PubChem CID 86606905) has the molecular formula C26H37N3O4SSi2 and a molecular weight of 543.84 g/mol. Its IUPAC name is 4-amino-5-[1,4-bis(trimethylsilyl)but-1-en-3-ynyl]-6-ethoxy-N-[(4-methylsulfonylphenyl)methyl]pyridine-2-carboxamide.
| Compound Name | 4-amino-5-[1,4-bis(trimethylsilyl)but-1-en-3-ynyl]-6-ethoxy-N-[(4-methylsulfonylphenyl)methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 86606905 |
| Molecular Formula | C26H37N3O4SSi2 |
| Molecular Weight | 543.84 g/mol |
| Exact Mass | 543.20 |
| IUPAC Name | 4-amino-5-[1,4-bis(trimethylsilyl)but-1-en-3-ynyl]-6-ethoxy-N-[(4-methylsulfonylphenyl)methyl]pyridine-2-carboxamide |
| SMILES | CCOc1nc(C(=O)NCc2ccc(S(C)(=O)=O)cc2)cc(N)c1C(=CC#C[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C26H37N3O4SSi2/c1-9-33-26-24(23(36(6,7)8)11-10-16-35(3,4)5)21(27)17-22(29-26)25(30)28-18-19-12-14-20(15-13-19)34(2,31)32/h11-15,17H,9,18H2,1-8H3,(H2,27,29)(H,28,30) |
| InChIKey | YVUSJSKGVRXYIR-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.84 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|