C32H36F6N6O3 — CID 86610679
ethyl 1-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-[[(2R,4S)-2-ethyl-6-methoxy-1,2,3,4-tetrahydro-1,5-naphthyridin-4-yl]amino]pyrimidin-5-yl]piperidine-4-carboxylate (PubChem CID 86610679) has the molecular formula C32H36F6N6O3 and a molecular weight of 666.67 g/mol. Its IUPAC name is ethyl 1-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-[[(2R,4S)-2-ethyl-6-methoxy-1,2,3,4-tetrahydro-1,5-naphthyridin-4-yl]amino]pyrimidin-5-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-[[(2R,4S)-2-ethyl-6-methoxy-1,2,3,4-tetrahydro-1,5-naphthyridin-4-yl]amino]pyrimidin-5-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 86610679 |
| Molecular Formula | C32H36F6N6O3 |
| Molecular Weight | 666.67 g/mol |
| Exact Mass | 666.28 |
| IUPAC Name | ethyl 1-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-[[(2R,4S)-2-ethyl-6-methoxy-1,2,3,4-tetrahydro-1,5-naphthyridin-4-yl]amino]pyrimidin-5-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2cnc(N[C@H]3C[C@@H](CC)Nc4ccc(OC)nc43)nc2Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C32H36F6N6O3/c1-4-22-16-25(28-23(40-22)6-7-27(43-28)46-3)42-30-39-17-26(44-10-8-19(9-11-44)29(45)47-5-2)24(41-30)14-18-12-20(31(33,34)35)15-21(13-18)32(36,37)38/h6-7,12-13,15,17,19,22,25,40H,4-5,8-11,14,16H2,1-3H3,(H,39,41,42)/t22-,25+/m1/s1 |
| InChIKey | NRKJFXVQQJOPLV-RDGATRHJSA-N |
| XLogP | 7.04 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.67 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |