C24H28N2O3 — CID 86616407
benzyl 2-[(9S)-11-oxo-9-phenyl-6,10-diazaspiro[4.6]undecan-10-yl]acetate (PubChem CID 86616407) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is benzyl 2-[(9S)-11-oxo-9-phenyl-6,10-diazaspiro[4.6]undecan-10-yl]acetate.
| Compound Name | benzyl 2-[(9S)-11-oxo-9-phenyl-6,10-diazaspiro[4.6]undecan-10-yl]acetate |
|---|---|
| PubChem CID | 86616407 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | benzyl 2-[(9S)-11-oxo-9-phenyl-6,10-diazaspiro[4.6]undecan-10-yl]acetate |
| SMILES | O=C(CN1C(=O)C2(CCCC2)NCC[C@H]1c1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C24H28N2O3/c27-22(29-18-19-9-3-1-4-10-19)17-26-21(20-11-5-2-6-12-20)13-16-25-24(23(26)28)14-7-8-15-24/h1-6,9-12,21,25H,7-8,13-18H2/t21-/m0/s1 |
| InChIKey | MPKAVGVHNYQOFL-NRFANRHFSA-N |
| XLogP | 3.61 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |