C10H6ClN5O2 — CID 86628662
1-(6-chloro-3-pyridinyl)-3,7-dihydropurine-2,6-dione (PubChem CID 86628662) has the molecular formula C10H6ClN5O2 and a molecular weight of 263.64 g/mol. Its IUPAC name is 1-(6-chloro-3-pyridinyl)-3,7-dihydropurine-2,6-dione.
| Compound Name | 1-(6-chloro-3-pyridinyl)-3,7-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 86628662 |
| Molecular Formula | C10H6ClN5O2 |
| Molecular Weight | 263.64 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | 1-(6-chloro-3-pyridinyl)-3,7-dihydropurine-2,6-dione |
| SMILES | O=c1[nH]c2nc[nH]c2c(=O)n1-c1ccc(Cl)nc1 |
| InChI | InChI=1S/C10H6ClN5O2/c11-6-2-1-5(3-12-6)16-9(17)7-8(14-4-13-7)15-10(16)18/h1-4H,(H,13,14)(H,15,18) |
| InChIKey | PAPJBVCBSCHDQT-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 96.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.64 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|