C13H10O3 — CID 86632047
1H-cyclopenta[a]naphthalene-1,2,3-triol (PubChem CID 86632047) has the molecular formula C13H10O3 and a molecular weight of 214.22 g/mol. Its IUPAC name is 1H-cyclopenta[a]naphthalene-1,2,3-triol.
| Compound Name | 1H-cyclopenta[a]naphthalene-1,2,3-triol |
|---|---|
| PubChem CID | 86632047 |
| Molecular Formula | C13H10O3 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 1H-cyclopenta[a]naphthalene-1,2,3-triol |
| SMILES | OC1=C(O)C(O)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C13H10O3/c14-11-9-6-5-7-3-1-2-4-8(7)10(9)12(15)13(11)16/h1-6,12,14-16H |
| InChIKey | MGBQSTRJZWMQBF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |