C15H14O2 — CID 10704431
1-(3-hydroxypropyl)-1H-cyclobuta[a]naphthalen-2-one (PubChem CID 10704431) has the molecular formula C15H14O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is 1-(3-hydroxypropyl)-1H-cyclobuta[a]naphthalen-2-one.
| Compound Name | 1-(3-hydroxypropyl)-1H-cyclobuta[a]naphthalen-2-one |
|---|---|
| PubChem CID | 10704431 |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 1-(3-hydroxypropyl)-1H-cyclobuta[a]naphthalen-2-one |
| SMILES | O=C1c2ccc3ccccc3c2C1CCCO |
| InChI | InChI=1S/C15H14O2/c16-9-3-6-12-14-11-5-2-1-4-10(11)7-8-13(14)15(12)17/h1-2,4-5,7-8,12,16H,3,6,9H2 |
| InChIKey | XXLYVSXOYLEXDQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |