C15H17NO2 — CID 84630884
3-(3,4-dihydro-2H-benzo[h][1,4]benzoxazin-3-yl)propan-1-ol (PubChem CID 84630884) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-benzo[h][1,4]benzoxazin-3-yl)propan-1-ol.
| Compound Name | 3-(3,4-dihydro-2H-benzo[h][1,4]benzoxazin-3-yl)propan-1-ol |
|---|---|
| PubChem CID | 84630884 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 3-(3,4-dihydro-2H-benzo[h][1,4]benzoxazin-3-yl)propan-1-ol |
| SMILES | OCCCC1COc2c(ccc3ccccc23)N1 |
| InChI | InChI=1S/C15H17NO2/c17-9-3-5-12-10-18-15-13-6-2-1-4-11(13)7-8-14(15)16-12/h1-2,4,6-8,12,16-17H,3,5,9-10H2 |
| InChIKey | CJXRVDHTGAUGDY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |