C22H23F6NO6 — CID 86639438
1-(3-ethoxy-4-nitrophenoxy)-4-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-2-propylbenzene (PubChem CID 86639438) has the molecular formula C22H23F6NO6 and a molecular weight of 511.42 g/mol. Its IUPAC name is 1-(3-ethoxy-4-nitrophenoxy)-4-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-2-propylbenzene.
| Compound Name | 1-(3-ethoxy-4-nitrophenoxy)-4-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-2-propylbenzene |
|---|---|
| PubChem CID | 86639438 |
| Molecular Formula | C22H23F6NO6 |
| Molecular Weight | 511.42 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | 1-(3-ethoxy-4-nitrophenoxy)-4-[1,1,1,3,3,3-hexafluoro-2-(methoxymethoxy)propan-2-yl]-2-propylbenzene |
| SMILES | CCCc1cc(C(OCOC)(C(F)(F)F)C(F)(F)F)ccc1Oc1ccc([N+](=O)[O-])c(OCC)c1 |
| InChI | InChI=1S/C22H23F6NO6/c1-4-6-14-11-15(20(21(23,24)25,22(26,27)28)34-13-32-3)7-10-18(14)35-16-8-9-17(29(30)31)19(12-16)33-5-2/h7-12H,4-6,13H2,1-3H3 |
| InChIKey | ZFMRJYLYLRZZKC-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.42 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|