C30H30ClF3N6O5S — CID 86654625
tert-butyl 4-[5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]-2-(methoxycarbamoyl)piperazine-1-carboxylate (PubChem CID 86654625) has the molecular formula C30H30ClF3N6O5S and a molecular weight of 679.12 g/mol. Its IUPAC name is tert-butyl 4-[5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]-2-(methoxycarbamoyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]-2-(methoxycarbamoyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 86654625 |
| Molecular Formula | C30H30ClF3N6O5S |
| Molecular Weight | 679.12 g/mol |
| Exact Mass | 678.16 |
| IUPAC Name | tert-butyl 4-[5-[[1-[[4-chloro-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]-2-(methoxycarbamoyl)piperazine-1-carboxylate |
| SMILES | CONC(=O)C1CN(C2=NC(=O)C(=Cc3ccc4c(cnn4Cc4ccc(Cl)cc4C(F)(F)F)c3)S2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H30ClF3N6O5S/c1-29(2,3)45-28(43)39-10-9-38(16-23(39)25(41)37-44-4)27-36-26(42)24(46-27)12-17-5-8-22-19(11-17)14-35-40(22)15-18-6-7-20(31)13-21(18)30(32,33)34/h5-8,11-14,23H,9-10,15-16H2,1-4H3,(H,37,41) |
| InChIKey | PWNGIUAYKGBKJM-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.12 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|