C21H35IO4SSi2 — CID 86660522
(1R,7S,8R)-1,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4-iodo-9-oxa-5-thiatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-one (PubChem CID 86660522) has the molecular formula C21H35IO4SSi2 and a molecular weight of 566.65 g/mol. Its IUPAC name is (1R,7S,8R)-1,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4-iodo-9-oxa-5-thiatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-one.
| Compound Name | (1R,7S,8R)-1,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4-iodo-9-oxa-5-thiatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-one |
|---|---|
| PubChem CID | 86660522 |
| Molecular Formula | C21H35IO4SSi2 |
| Molecular Weight | 566.65 g/mol |
| Exact Mass | 566.08 |
| IUPAC Name | (1R,7S,8R)-1,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4-iodo-9-oxa-5-thiatricyclo[6.2.1.02,6]undeca-2(6),3-dien-10-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1c2sc(I)cc2[C@]2(O[Si](C)(C)C(C)(C)C)C[C@H]1OC2=O |
| InChI | InChI=1S/C21H35IO4SSi2/c1-19(2,3)28(7,8)25-16-14-12-21(18(23)24-14,13-11-15(22)27-17(13)16)26-29(9,10)20(4,5)6/h11,14,16H,12H2,1-10H3/t14-,16+,21-/m1/s1 |
| InChIKey | NHBXLOXPSSPZBZ-IVZHQMGZSA-N |
| XLogP | 6.96 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.65 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|