C22H35NO6S — CID 86665530
benzyl N-[2-methyl-4-(1,4,7,10-tetraoxacyclododec-2-ylmethylsulfanyl)butan-2-yl]carbamate (PubChem CID 86665530) has the molecular formula C22H35NO6S and a molecular weight of 441.59 g/mol. Its IUPAC name is benzyl N-[2-methyl-4-(1,4,7,10-tetraoxacyclododec-2-ylmethylsulfanyl)butan-2-yl]carbamate.
| Compound Name | benzyl N-[2-methyl-4-(1,4,7,10-tetraoxacyclododec-2-ylmethylsulfanyl)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 86665530 |
| Molecular Formula | C22H35NO6S |
| Molecular Weight | 441.59 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | benzyl N-[2-methyl-4-(1,4,7,10-tetraoxacyclododec-2-ylmethylsulfanyl)butan-2-yl]carbamate |
| SMILES | CC(C)(CCSCC1COCCOCCOCCO1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H35NO6S/c1-22(2,23-21(24)29-16-19-6-4-3-5-7-19)8-15-30-18-20-17-27-12-11-25-9-10-26-13-14-28-20/h3-7,20H,8-18H2,1-2H3,(H,23,24) |
| InChIKey | NNNBYSRYSCIWFT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.59 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|