C15H32NO6P — CID 86678283
tert-butyl N-[(2S)-1-(3-diethoxyphosphorylpropoxy)propan-2-yl]carbamate (PubChem CID 86678283) has the molecular formula C15H32NO6P and a molecular weight of 353.40 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(3-diethoxyphosphorylpropoxy)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(3-diethoxyphosphorylpropoxy)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 86678283 |
| Molecular Formula | C15H32NO6P |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | tert-butyl N-[(2S)-1-(3-diethoxyphosphorylpropoxy)propan-2-yl]carbamate |
| SMILES | CCOP(=O)(CCCOC[C@H](C)NC(=O)OC(C)(C)C)OCC |
| InChI | InChI=1S/C15H32NO6P/c1-7-20-23(18,21-8-2)11-9-10-19-12-13(3)16-14(17)22-15(4,5)6/h13H,7-12H2,1-6H3,(H,16,17)/t13-/m0/s1 |
| InChIKey | ZCUPNGCCWFRTIE-ZDUSSCGKSA-N |
| XLogP | 3.57 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|