C48H68Br2S2 — CID 86718301
6,15-dibromo-9,18-bis(2-hexyldecylidene)-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1,3(10),4(8),6,11,13(17),15-heptaene (PubChem CID 86718301) has the molecular formula C48H68Br2S2 and a molecular weight of 869.01 g/mol. Its IUPAC name is 6,15-dibromo-9,18-bis(2-hexyldecylidene)-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1,3(10),4(8),6,11,13(17),15-heptaene.
| Compound Name | 6,15-dibromo-9,18-bis(2-hexyldecylidene)-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1,3(10),4(8),6,11,13(17),15-heptaene |
|---|---|
| PubChem CID | 86718301 |
| Molecular Formula | C48H68Br2S2 |
| Molecular Weight | 869.01 g/mol |
| Exact Mass | 866.31 |
| IUPAC Name | 6,15-dibromo-9,18-bis(2-hexyldecylidene)-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1,3(10),4(8),6,11,13(17),15-heptaene |
| SMILES | CCCCCCCCC(C=C1c2cc3c(cc2-c2sc(Br)cc21)C(=CC(CCCCCC)CCCCCCCC)c1cc(Br)sc1-3)CCCCCC |
| InChI | InChI=1S/C48H68Br2S2/c1-5-9-13-17-19-23-27-35(25-21-15-11-7-3)29-37-39-31-42-40(32-41(39)47-43(37)33-45(49)51-47)38(44-34-46(50)52-48(42)44)30-36(26-22-16-12-8-4)28-24-20-18-14-10-6-2/h29-36H,5-28H2,1-4H3 |
| InChIKey | PRPWFUDAPPBKPL-UHFFFAOYSA-N |
| XLogP | 18.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 869.01 |
| LogP ≤ 5 | 18.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|