C10H7ClF3NO4S — CID 86723734
(8-chloro-1-oxo-3,4-dihydro-2H-isoquinolin-7-yl) trifluoromethanesulfonate (PubChem CID 86723734) has the molecular formula C10H7ClF3NO4S and a molecular weight of 329.68 g/mol. Its IUPAC name is (8-chloro-1-oxo-3,4-dihydro-2H-isoquinolin-7-yl) trifluoromethanesulfonate.
| Compound Name | (8-chloro-1-oxo-3,4-dihydro-2H-isoquinolin-7-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 86723734 |
| Molecular Formula | C10H7ClF3NO4S |
| Molecular Weight | 329.68 g/mol |
| Exact Mass | 328.97 |
| IUPAC Name | (8-chloro-1-oxo-3,4-dihydro-2H-isoquinolin-7-yl) trifluoromethanesulfonate |
| SMILES | O=C1NCCc2ccc(OS(=O)(=O)C(F)(F)F)c(Cl)c21 |
| InChI | InChI=1S/C10H7ClF3NO4S/c11-8-6(19-20(17,18)10(12,13)14)2-1-5-3-4-15-9(16)7(5)8/h1-2H,3-4H2,(H,15,16) |
| InChIKey | DIWBETSFOYKHPJ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.68 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|