C15H20N4O5S — CID 86802539
4-[3-(cyanomethyl)-3-hydroxyazetidin-1-yl]-N,N-diethyl-3-nitrobenzenesulfonamide (PubChem CID 86802539) has the molecular formula C15H20N4O5S and a molecular weight of 368.42 g/mol. Its IUPAC name is 4-[3-(cyanomethyl)-3-hydroxyazetidin-1-yl]-N,N-diethyl-3-nitrobenzenesulfonamide.
| Compound Name | 4-[3-(cyanomethyl)-3-hydroxyazetidin-1-yl]-N,N-diethyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 86802539 |
| Molecular Formula | C15H20N4O5S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 4-[3-(cyanomethyl)-3-hydroxyazetidin-1-yl]-N,N-diethyl-3-nitrobenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N2CC(O)(CC#N)C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H20N4O5S/c1-3-18(4-2)25(23,24)12-5-6-13(14(9-12)19(21)22)17-10-15(20,11-17)7-8-16/h5-6,9,20H,3-4,7,10-11H2,1-2H3 |
| InChIKey | SRMSLXOGDGHOBT-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 127.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|