C15H12BrN3O5 — CID 86830444
N-(6-bromo-3,4-dihydro-2H-chromen-4-yl)-5-nitro-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 86830444) has the molecular formula C15H12BrN3O5 and a molecular weight of 394.18 g/mol. Its IUPAC name is N-(6-bromo-3,4-dihydro-2H-chromen-4-yl)-5-nitro-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-(6-bromo-3,4-dihydro-2H-chromen-4-yl)-5-nitro-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 86830444 |
| Molecular Formula | C15H12BrN3O5 |
| Molecular Weight | 394.18 g/mol |
| Exact Mass | 393.00 |
| IUPAC Name | N-(6-bromo-3,4-dihydro-2H-chromen-4-yl)-5-nitro-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | O=C(NC1CCOc2ccc(Br)cc21)c1cc([N+](=O)[O-])c[nH]c1=O |
| InChI | InChI=1S/C15H12BrN3O5/c16-8-1-2-13-10(5-8)12(3-4-24-13)18-15(21)11-6-9(19(22)23)7-17-14(11)20/h1-2,5-7,12H,3-4H2,(H,17,20)(H,18,21) |
| InChIKey | LBLHEOFCXQXFTO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 114.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.18 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|